C21H21Cl2NO7 — CID 55468705
[2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 55468705) has the molecular formula C21H21Cl2NO7 and a molecular weight of 470.31 g/mol. Its IUPAC name is [2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55468705 |
| Molecular Formula | C21H21Cl2NO7 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | [2-(5-chloro-2,4-dimethoxyanilino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(OC)c(NC(=O)COC(=O)/C=C/c2cc(Cl)c(OC)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C21H21Cl2NO7/c1-27-16-10-17(28-2)15(9-13(16)22)24-19(25)11-31-20(26)6-5-12-7-14(23)21(30-4)18(8-12)29-3/h5-10H,11H2,1-4H3,(H,24,25)/b6-5+ |
| InChIKey | VHSYFJGECCIKEK-AATRIKPKSA-N |
| XLogP | 4.22 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|