C20H24ClNO6 — CID 55309883
[2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 55309883) has the molecular formula C20H24ClNO6 and a molecular weight of 409.87 g/mol. Its IUPAC name is [2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55309883 |
| Molecular Formula | C20H24ClNO6 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NC(=O)C2CCCCC2)cc(Cl)c1OC |
| InChI | InChI=1S/C20H24ClNO6/c1-26-16-11-13(10-15(21)19(16)27-2)8-9-18(24)28-12-17(23)22-20(25)14-6-4-3-5-7-14/h8-11,14H,3-7,12H2,1-2H3,(H,22,23,25)/b9-8+ |
| InChIKey | NEXPXVYOONJUNG-CMDGGOBGSA-N |
| XLogP | 3.14 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|