C23H26ClNO7 — CID 41070506
[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 41070506) has the molecular formula C23H26ClNO7 and a molecular weight of 463.91 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 41070506 |
| Molecular Formula | C23H26ClNO7 |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(CCNC(=O)COC(=O)/C=C/c2cc(Cl)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C23H26ClNO7/c1-28-18-7-5-15(12-19(18)29-2)9-10-25-21(26)14-32-22(27)8-6-16-11-17(24)23(31-4)20(13-16)30-3/h5-8,11-13H,9-10,14H2,1-4H3,(H,25,26)/b8-6+ |
| InChIKey | VZVYSYDUMSPEET-SOFGYWHQSA-N |
| XLogP | 3.29 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|