C17H21ClN2O6 — CID 2567602
[2-oxo-2-(propylcarbamoylamino)ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 2567602) has the molecular formula C17H21ClN2O6 and a molecular weight of 384.82 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2567602 |
| Molecular Formula | C17H21ClN2O6 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)/C=C/c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H21ClN2O6/c1-4-7-19-17(23)20-14(21)10-26-15(22)6-5-11-8-12(18)16(25-3)13(9-11)24-2/h5-6,8-9H,4,7,10H2,1-3H3,(H2,19,20,21,23)/b6-5+ |
| InChIKey | HKMIQQUIKKCLKD-AATRIKPKSA-N |
| XLogP | 2.15 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|