C16H18ClNO7 — CID 2492798
[2-(ethoxycarbonylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 2492798) has the molecular formula C16H18ClNO7 and a molecular weight of 371.77 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2492798 |
| Molecular Formula | C16H18ClNO7 |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)/C=C/c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H18ClNO7/c1-4-24-16(21)18-13(19)9-25-14(20)6-5-10-7-11(17)15(23-3)12(8-10)22-2/h5-8H,4,9H2,1-3H3,(H,18,19,21)/b6-5+ |
| InChIKey | ZBIHFIWZVBJWOM-AATRIKPKSA-N |
| XLogP | 2.19 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|