C12H12Cl2O3 — CID 67390103
ethyl (E)-3-(3,5-dichloro-4-methoxyphenyl)prop-2-enoate (PubChem CID 67390103) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is ethyl (E)-3-(3,5-dichloro-4-methoxyphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(3,5-dichloro-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 67390103 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | ethyl (E)-3-(3,5-dichloro-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(Cl)c(OC)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2O3/c1-3-17-11(15)5-4-8-6-9(13)12(16-2)10(14)7-8/h4-7H,3H2,1-2H3/b5-4+ |
| InChIKey | KYRLWNKCPCRYGU-SNAWJCMRSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|