C21H22ClNO5 — CID 2492923
[2-(N-ethylanilino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 2492923) has the molecular formula C21H22ClNO5 and a molecular weight of 403.86 g/mol. Its IUPAC name is [2-(N-ethylanilino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(N-ethylanilino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2492923 |
| Molecular Formula | C21H22ClNO5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [2-(N-ethylanilino)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCN(C(=O)COC(=O)/C=C/c1cc(Cl)c(OC)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C21H22ClNO5/c1-4-23(16-8-6-5-7-9-16)19(24)14-28-20(25)11-10-15-12-17(22)21(27-3)18(13-15)26-2/h5-13H,4,14H2,1-3H3/b11-10+ |
| InChIKey | YAFNAZHYBASRJS-ZHACJKMWSA-N |
| XLogP | 3.97 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|