C18H16ClFO4 — CID 7757663
(2-fluorophenyl)methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 7757663) has the molecular formula C18H16ClFO4 and a molecular weight of 350.77 g/mol. Its IUPAC name is (2-fluorophenyl)methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (2-fluorophenyl)methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7757663 |
| Molecular Formula | C18H16ClFO4 |
| Molecular Weight | 350.77 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (2-fluorophenyl)methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2ccccc2F)cc(Cl)c1OC |
| InChI | InChI=1S/C18H16ClFO4/c1-22-16-10-12(9-14(19)18(16)23-2)7-8-17(21)24-11-13-5-3-4-6-15(13)20/h3-10H,11H2,1-2H3/b8-7+ |
| InChIKey | DRZWMKOIVXADEA-BQYQJAHWSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|