C18H17FO4 — CID 8664716
(2-fluorophenyl)methyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 8664716) has the molecular formula C18H17FO4 and a molecular weight of 316.33 g/mol. Its IUPAC name is (2-fluorophenyl)methyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (2-fluorophenyl)methyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8664716 |
| Molecular Formula | C18H17FO4 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2-fluorophenyl)methyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2ccccc2F)cc(OC)c1 |
| InChI | InChI=1S/C18H17FO4/c1-21-15-9-13(10-16(11-15)22-2)7-8-18(20)23-12-14-5-3-4-6-17(14)19/h3-11H,12H2,1-2H3/b8-7+ |
| InChIKey | LVAYJKCILZXVQF-BQYQJAHWSA-N |
| XLogP | 3.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|