C20H20FNO4 — CID 9011066
[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 9011066) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9011066 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)NCCc2ccccc2F)cc1 |
| InChI | InChI=1S/C20H20FNO4/c1-25-17-9-6-15(7-10-17)8-11-20(24)26-14-19(23)22-13-12-16-4-2-3-5-18(16)21/h2-11H,12-14H2,1H3,(H,22,23)/b11-8+ |
| InChIKey | GLGARNMNYUCCJR-DHZHZOJOSA-N |
| XLogP | 2.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|