C20H18F2N2O5 — CID 9011002
[2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 9011002) has the molecular formula C20H18F2N2O5 and a molecular weight of 404.37 g/mol. Its IUPAC name is [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9011002 |
| Molecular Formula | C20H18F2N2O5 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)NCC(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H18F2N2O5/c1-28-15-6-2-13(3-7-15)4-9-20(27)29-12-19(26)23-11-18(25)24-14-5-8-16(21)17(22)10-14/h2-10H,11-12H2,1H3,(H,23,26)(H,24,25)/b9-4+ |
| InChIKey | BXIPBYHGNKYFSB-RUDMXATFSA-N |
| XLogP | 2.28 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|