C19H15ClF2N2O4 — CID 9018627
[2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 9018627) has the molecular formula C19H15ClF2N2O4 and a molecular weight of 408.79 g/mol. Its IUPAC name is [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9018627 |
| Molecular Formula | C19H15ClF2N2O4 |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(Cl)cc1)NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H15ClF2N2O4/c20-13-4-1-12(2-5-13)3-8-19(27)28-11-18(26)23-10-17(25)24-14-6-7-15(21)16(22)9-14/h1-9H,10-11H2,(H,23,26)(H,24,25)/b8-3+ |
| InChIKey | ZEKMNHVPIBTISD-FPYGCLRLSA-N |
| XLogP | 2.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|