C16H15F2N3O2S — CID 8682019
N-(3,4-difluorophenyl)-2-[(4-methoxyphenyl)carbamothioylamino]acetamide (PubChem CID 8682019) has the molecular formula C16H15F2N3O2S and a molecular weight of 351.38 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[(4-methoxyphenyl)carbamothioylamino]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[(4-methoxyphenyl)carbamothioylamino]acetamide |
|---|---|
| PubChem CID | 8682019 |
| Molecular Formula | C16H15F2N3O2S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[(4-methoxyphenyl)carbamothioylamino]acetamide |
| SMILES | COc1ccc(NC(=S)NCC(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H15F2N3O2S/c1-23-12-5-2-10(3-6-12)21-16(24)19-9-15(22)20-11-4-7-13(17)14(18)8-11/h2-8H,9H2,1H3,(H,20,22)(H2,19,21,24) |
| InChIKey | VFJXINDMIOJHGL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|