C24H23F2N3O3 — CID 16610921
2-[[2-(N-benzyl-4-methoxyanilino)acetyl]amino]-N-(3,4-difluorophenyl)acetamide (PubChem CID 16610921) has the molecular formula C24H23F2N3O3 and a molecular weight of 439.46 g/mol. Its IUPAC name is 2-[[2-(N-benzyl-4-methoxyanilino)acetyl]amino]-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-[[2-(N-benzyl-4-methoxyanilino)acetyl]amino]-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 16610921 |
| Molecular Formula | C24H23F2N3O3 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-[[2-(N-benzyl-4-methoxyanilino)acetyl]amino]-N-(3,4-difluorophenyl)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCC(=O)Nc2ccc(F)c(F)c2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23F2N3O3/c1-32-20-10-8-19(9-11-20)29(15-17-5-3-2-4-6-17)16-24(31)27-14-23(30)28-18-7-12-21(25)22(26)13-18/h2-13H,14-16H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | PPHXTDPQTHFIHK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|