C23H22FN3O3 — CID 16610917
2-(N-benzyl-4-methoxyanilino)-N-[(2-fluorophenyl)carbamoyl]acetamide (PubChem CID 16610917) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is 2-(N-benzyl-4-methoxyanilino)-N-[(2-fluorophenyl)carbamoyl]acetamide.
| Compound Name | 2-(N-benzyl-4-methoxyanilino)-N-[(2-fluorophenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 16610917 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-(N-benzyl-4-methoxyanilino)-N-[(2-fluorophenyl)carbamoyl]acetamide |
| SMILES | COc1ccc(N(CC(=O)NC(=O)Nc2ccccc2F)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22FN3O3/c1-30-19-13-11-18(12-14-19)27(15-17-7-3-2-4-8-17)16-22(28)26-23(29)25-21-10-6-5-9-20(21)24/h2-14H,15-16H2,1H3,(H2,25,26,28,29) |
| InChIKey | GLYSMAIVZLHSCM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|