C28H30FN3O4 — CID 3220057
N'-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N-(2-fluorophenyl)-N'-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 3220057) has the molecular formula C28H30FN3O4 and a molecular weight of 491.56 g/mol. Its IUPAC name is N'-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N-(2-fluorophenyl)-N'-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N-(2-fluorophenyl)-N'-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 3220057 |
| Molecular Formula | C28H30FN3O4 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | N'-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N-(2-fluorophenyl)-N'-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccc(CN(C(=O)C(=O)Nc2ccccc2F)C(C(=O)NC(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30FN3O4/c1-28(2,3)31-25(33)24(20-10-6-5-7-11-20)32(18-19-14-16-21(36-4)17-15-19)27(35)26(34)30-23-13-9-8-12-22(23)29/h5-17,24H,18H2,1-4H3,(H,30,34)(H,31,33) |
| InChIKey | JXONFLMSACYZBN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|