C27H36N4O4 — CID 3220033
N'-[2-(tert-butylamino)-1-(4-methoxyphenyl)-2-oxoethyl]-N-cyclohexyl-N'-(pyridin-3-ylmethyl)oxamide (PubChem CID 3220033) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is N'-[2-(tert-butylamino)-1-(4-methoxyphenyl)-2-oxoethyl]-N-cyclohexyl-N'-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N'-[2-(tert-butylamino)-1-(4-methoxyphenyl)-2-oxoethyl]-N-cyclohexyl-N'-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 3220033 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | N'-[2-(tert-butylamino)-1-(4-methoxyphenyl)-2-oxoethyl]-N-cyclohexyl-N'-(pyridin-3-ylmethyl)oxamide |
| SMILES | COc1ccc(C(C(=O)NC(C)(C)C)N(Cc2cccnc2)C(=O)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H36N4O4/c1-27(2,3)30-24(32)23(20-12-14-22(35-4)15-13-20)31(18-19-9-8-16-28-17-19)26(34)25(33)29-21-10-6-5-7-11-21/h8-9,12-17,21,23H,5-7,10-11,18H2,1-4H3,(H,29,33)(H,30,32) |
| InChIKey | DWTKLGCORARTQC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|