C28H35FN4O3 — CID 3220032
N-cyclohexyl-N'-[2-(cyclohexylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N'-(pyridin-3-ylmethyl)oxamide (PubChem CID 3220032) has the molecular formula C28H35FN4O3 and a molecular weight of 494.61 g/mol. Its IUPAC name is N-cyclohexyl-N'-[2-(cyclohexylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N'-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N-cyclohexyl-N'-[2-(cyclohexylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N'-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 3220032 |
| Molecular Formula | C28H35FN4O3 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | N-cyclohexyl-N'-[2-(cyclohexylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N'-(pyridin-3-ylmethyl)oxamide |
| SMILES | O=C(NC1CCCCC1)C(=O)N(Cc1cccnc1)C(C(=O)NC1CCCCC1)c1ccccc1F |
| InChI | InChI=1S/C28H35FN4O3/c29-24-16-8-7-15-23(24)25(26(34)31-21-11-3-1-4-12-21)33(19-20-10-9-17-30-18-20)28(36)27(35)32-22-13-5-2-6-14-22/h7-10,15-18,21-22,25H,1-6,11-14,19H2,(H,31,34)(H,32,35) |
| InChIKey | JVBPSXVBWSETAQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|