C24H27N3O2 — CID 166632953
N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]but-2-ynamide (PubChem CID 166632953) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]but-2-ynamide.
| Compound Name | N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]but-2-ynamide |
|---|---|
| PubChem CID | 166632953 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]but-2-ynamide |
| SMILES | CC#CC(=O)N(Cc1ccccc1)C(C(=O)NC1CCCCC1)c1cccnc1 |
| InChI | InChI=1S/C24H27N3O2/c1-2-10-22(28)27(18-19-11-5-3-6-12-19)23(20-13-9-16-25-17-20)24(29)26-21-14-7-4-8-15-21/h3,5-6,9,11-13,16-17,21,23H,4,7-8,14-15,18H2,1H3,(H,26,29) |
| InChIKey | UCOFBDHTRRRUAG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|