C23H29BN2O4 — CID 102127298
[3-[1-[acetyl(benzyl)amino]-2-(cyclohexylamino)-2-oxoethyl]phenyl]boronic acid (PubChem CID 102127298) has the molecular formula C23H29BN2O4 and a molecular weight of 408.31 g/mol. Its IUPAC name is [3-[1-[acetyl(benzyl)amino]-2-(cyclohexylamino)-2-oxoethyl]phenyl]boronic acid.
| Compound Name | [3-[1-[acetyl(benzyl)amino]-2-(cyclohexylamino)-2-oxoethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 102127298 |
| Molecular Formula | C23H29BN2O4 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | [3-[1-[acetyl(benzyl)amino]-2-(cyclohexylamino)-2-oxoethyl]phenyl]boronic acid |
| SMILES | CC(=O)N(Cc1ccccc1)C(C(=O)NC1CCCCC1)c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C23H29BN2O4/c1-17(27)26(16-18-9-4-2-5-10-18)22(19-11-8-12-20(15-19)24(29)30)23(28)25-21-13-6-3-7-14-21/h2,4-5,8-12,15,21-22,29-30H,3,6-7,13-14,16H2,1H3,(H,25,28) |
| InChIKey | SZTRKZHAXLIHQJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|