C30H40BrN3O3 — CID 154926601
N-benzyl-N-[1-(3-bromophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N'-tert-butyl-2,2-dimethylpropanediamide (PubChem CID 154926601) has the molecular formula C30H40BrN3O3 and a molecular weight of 570.57 g/mol. Its IUPAC name is N-benzyl-N-[1-(3-bromophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N'-tert-butyl-2,2-dimethylpropanediamide.
| Compound Name | N-benzyl-N-[1-(3-bromophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N'-tert-butyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 154926601 |
| Molecular Formula | C30H40BrN3O3 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | N-benzyl-N-[1-(3-bromophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N'-tert-butyl-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C)NC(=O)C(C)(C)C(=O)N(Cc1ccccc1)C(C(=O)NC1CCCCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C30H40BrN3O3/c1-29(2,3)33-27(36)30(4,5)28(37)34(20-21-13-8-6-9-14-21)25(22-15-12-16-23(31)19-22)26(35)32-24-17-10-7-11-18-24/h6,8-9,12-16,19,24-25H,7,10-11,17-18,20H2,1-5H3,(H,32,35)(H,33,36) |
| InChIKey | UHLYOYVIGVOWHW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|