C33H45N3O3 — CID 154926643
N-benzyl-N'-cyclohexyl-N-[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-2,2-dimethylpropanediamide (PubChem CID 154926643) has the molecular formula C33H45N3O3 and a molecular weight of 531.74 g/mol. Its IUPAC name is N-benzyl-N'-cyclohexyl-N-[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-2,2-dimethylpropanediamide.
| Compound Name | N-benzyl-N'-cyclohexyl-N-[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 154926643 |
| Molecular Formula | C33H45N3O3 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.35 |
| IUPAC Name | N-benzyl-N'-cyclohexyl-N-[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]-2,2-dimethylpropanediamide |
| SMILES | Cc1ccccc1C(C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)C(C)(C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C33H45N3O3/c1-24-15-13-14-22-28(24)29(30(37)34-26-18-9-5-10-19-26)36(23-25-16-7-4-8-17-25)32(39)33(2,3)31(38)35-27-20-11-6-12-21-27/h4,7-8,13-17,22,26-27,29H,5-6,9-12,18-21,23H2,1-3H3,(H,34,37)(H,35,38) |
| InChIKey | WESCZZGGPDECGR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|