C24H34N4O4 — CID 18015973
tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 18015973) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18015973 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(2-methylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | Cc1ccccc1C(C(=O)NC1CCCCC1)N(CC#N)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H34N4O4/c1-17-10-8-9-13-19(17)21(22(30)27-18-11-6-5-7-12-18)28(15-14-25)20(29)16-26-23(31)32-24(2,3)4/h8-10,13,18,21H,5-7,11-12,15-16H2,1-4H3,(H,26,31)(H,27,30) |
| InChIKey | HIZSEDOLPFOFJD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|