C25H36N4O4 — CID 18016093
tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(4-ethylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 18016093) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(4-ethylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(4-ethylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18016093 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(4-ethylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CCc1ccc(C(C(=O)NC2CCCCC2)N(CC#N)C(=O)CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H36N4O4/c1-5-18-11-13-19(14-12-18)22(23(31)28-20-9-7-6-8-10-20)29(16-15-26)21(30)17-27-24(32)33-25(2,3)4/h11-14,20,22H,5-10,16-17H2,1-4H3,(H,27,32)(H,28,31) |
| InChIKey | YOIOJFXQEZTEKV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|