C24H35N3O5 — CID 18016318
tert-butyl N-[2-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-2-oxoethyl]carbamate (PubChem CID 18016318) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18016318 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | tert-butyl N-[2-[[2-(cyclohexylamino)-1-(4-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-2-oxoethyl]carbamate |
| SMILES | C=CCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H35N3O5/c1-5-15-27(20(29)16-25-23(31)32-24(2,3)4)21(17-11-13-19(28)14-12-17)22(30)26-18-9-7-6-8-10-18/h5,11-14,18,21,28H,1,6-10,15-16H2,2-4H3,(H,25,31)(H,26,30) |
| InChIKey | VAGMAYNCCKWHPD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|