C23H32N4O5 — CID 18016018
tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 18016018) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18016018 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | tert-butyl N-[2-[cyanomethyl-[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N(CC#N)C(C(=O)NC1CCCCC1)c1cccc(O)c1 |
| InChI | InChI=1S/C23H32N4O5/c1-23(2,3)32-22(31)25-15-19(29)27(13-12-24)20(16-8-7-11-18(28)14-16)21(30)26-17-9-5-4-6-10-17/h7-8,11,14,17,20,28H,4-6,9-10,13,15H2,1-3H3,(H,25,31)(H,26,30) |
| InChIKey | LFXSULDVEKONRT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 131.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|