C24H33N3O5 — CID 18015838
tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate (PubChem CID 18015838) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18015838 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | tert-butyl N-[2-[[2-(cyclohexylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-ethynylamino]-2-oxoethyl]carbamate |
| SMILES | C#CN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1cccc(C)c1O |
| InChI | InChI=1S/C24H33N3O5/c1-6-27(19(28)15-25-23(31)32-24(3,4)5)20(18-14-10-11-16(2)21(18)29)22(30)26-17-12-8-7-9-13-17/h1,10-11,14,17,20,29H,7-9,12-13,15H2,2-5H3,(H,25,31)(H,26,30) |
| InChIKey | RAUNIZWLXHDISP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|