C23H31N3O6 — CID 18015696
ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-methylphenyl)acetyl]amino]propanoate (PubChem CID 18015696) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-methylphenyl)acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-methylphenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18015696 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-(2-methylphenyl)acetyl]amino]propanoate |
| SMILES | C#CN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NCCC(=O)OCC)c1ccccc1C |
| InChI | InChI=1S/C23H31N3O6/c1-7-26(18(27)15-25-22(30)32-23(4,5)6)20(17-12-10-9-11-16(17)3)21(29)24-14-13-19(28)31-8-2/h1,9-12,20H,8,13-15H2,2-6H3,(H,24,29)(H,25,30) |
| InChIKey | MMJOLNUOBJZCCC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|