C25H31N3O6S — CID 18055686
ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-(2-ethynylphenyl)acetyl]amino]propanoate (PubChem CID 18055686) has the molecular formula C25H31N3O6S and a molecular weight of 501.61 g/mol. Its IUPAC name is ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-(2-ethynylphenyl)acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-(2-ethynylphenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18055686 |
| Molecular Formula | C25H31N3O6S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | ethyl 3-[[2-[ethynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-(2-ethynylphenyl)acetyl]amino]propanoate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCC(=O)OCC)N(C#C)C(=O)C(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H31N3O6S/c1-7-17-12-10-11-13-18(17)21(22(30)26-15-14-20(29)33-9-3)28(8-2)23(31)19(16-35)27-24(32)34-25(4,5)6/h1-2,10-13,19,21,35H,9,14-16H2,3-6H3,(H,26,30)(H,27,32) |
| InChIKey | UPOIPQINKHXQNF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|