C30H44N4O7 — CID 18053976
ethyl 3-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-hexylamino]-2-(2-ethynylphenyl)acetyl]amino]propanoate (PubChem CID 18053976) has the molecular formula C30H44N4O7 and a molecular weight of 572.70 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-hexylamino]-2-(2-ethynylphenyl)acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-hexylamino]-2-(2-ethynylphenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18053976 |
| Molecular Formula | C30H44N4O7 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | ethyl 3-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-hexylamino]-2-(2-ethynylphenyl)acetyl]amino]propanoate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCC(=O)OCC)N(CCCCCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H44N4O7/c1-7-10-11-14-19-34(28(38)23(20-24(31)35)33-29(39)41-30(4,5)6)26(22-16-13-12-15-21(22)8-2)27(37)32-18-17-25(36)40-9-3/h2,12-13,15-16,23,26H,7,9-11,14,17-20H2,1,3-6H3,(H2,31,35)(H,32,37)(H,33,39) |
| InChIKey | GLKIHKIDNNIQAA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|