C29H45N3O4 — CID 18014067
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-hexylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014067) has the molecular formula C29H45N3O4 and a molecular weight of 499.70 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-hexylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-hexylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014067 |
| Molecular Formula | C29H45N3O4 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-hexylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCCCC)N(CCCCCC)C(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H45N3O4/c1-8-11-13-17-21-32(27(34)22(4)31-28(35)36-29(5,6)7)25(26(33)30-20-16-12-9-2)24-19-15-14-18-23(24)10-3/h3,14-15,18-19,22,25H,8-9,11-13,16-17,20-21H2,1-2,4-7H3,(H,30,33)(H,31,35) |
| InChIKey | QWWICNMOSVBCAA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|