C25H37N3O4 — CID 18011500
tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-propylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18011500) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-propylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-propylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18011500 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-propylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCCC)N(CCC)C(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H37N3O4/c1-8-11-16-26-22(29)21(20-15-13-12-14-19(20)10-3)28(17-9-2)23(30)18(4)27-24(31)32-25(5,6)7/h3,12-15,18,21H,8-9,11,16-17H2,1-2,4-7H3,(H,26,29)(H,27,31) |
| InChIKey | JTJCDJHLCSNGJA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|