C29H43N3O6 — CID 18014932
methyl 2-[[2-(2-ethynylphenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl-octylamino]acetyl]amino]acetate (PubChem CID 18014932) has the molecular formula C29H43N3O6 and a molecular weight of 529.68 g/mol. Its IUPAC name is methyl 2-[[2-(2-ethynylphenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl-octylamino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(2-ethynylphenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl-octylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 18014932 |
| Molecular Formula | C29H43N3O6 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | methyl 2-[[2-(2-ethynylphenyl)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl-octylamino]acetyl]amino]acetate |
| SMILES | C#Cc1ccccc1C(C(=O)NCC(=O)OC)N(CCCCCCCC)C(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H43N3O6/c1-8-10-11-12-13-16-19-32(27(35)21(3)31-28(36)38-29(4,5)6)25(26(34)30-20-24(33)37-7)23-18-15-14-17-22(23)9-2/h2,14-15,17-18,21,25H,8,10-13,16,19-20H2,1,3-7H3,(H,30,34)(H,31,36) |
| InChIKey | BKTMYFPBEAXJFH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|