C31H49N3O4 — CID 18014922
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014922) has the molecular formula C31H49N3O4 and a molecular weight of 527.75 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014922 |
| Molecular Formula | C31H49N3O4 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.37 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCCCC)N(CCCCCCCC)C(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H49N3O4/c1-8-11-13-14-15-19-23-34(29(36)24(4)33-30(37)38-31(5,6)7)27(28(35)32-22-18-12-9-2)26-21-17-16-20-25(26)10-3/h3,16-17,20-21,24,27H,8-9,11-15,18-19,22-23H2,1-2,4-7H3,(H,32,35)(H,33,37) |
| InChIKey | VXARFFQBDRVQIP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|