C30H47N3O5 — CID 18037720
tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-octylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 18037720) has the molecular formula C30H47N3O5 and a molecular weight of 529.72 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-octylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-octylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18037720 |
| Molecular Formula | C30H47N3O5 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.35 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-octylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCCC)N(CCCCCCCC)C(=O)C(CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H47N3O5/c1-7-10-12-13-14-17-21-33(28(36)25(22-34)32-29(37)38-30(4,5)6)26(27(35)31-20-11-8-2)24-19-16-15-18-23(24)9-3/h3,15-16,18-19,25-26,34H,7-8,10-14,17,20-22H2,1-2,4-6H3,(H,31,35)(H,32,37) |
| InChIKey | NNNGACNIFIZBRT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|