C32H43N3O5 — CID 18037440
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-heptylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 18037440) has the molecular formula C32H43N3O5 and a molecular weight of 549.71 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-heptylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-heptylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18037440 |
| Molecular Formula | C32H43N3O5 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-heptylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1ccccc1C)N(CCCCCCC)C(=O)C(CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H43N3O5/c1-7-9-10-11-16-21-35(30(38)27(22-36)34-31(39)40-32(4,5)6)28(25-19-14-13-18-24(25)8-2)29(37)33-26-20-15-12-17-23(26)3/h2,12-15,17-20,27-28,36H,7,9-11,16,21-22H2,1,3-6H3,(H,33,37)(H,34,39) |
| InChIKey | XXABWLMQWCSXIJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|