C30H43N3O5S — CID 18060135
tert-butyl N-[1-[heptyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18060135) has the molecular formula C30H43N3O5S and a molecular weight of 557.76 g/mol. Its IUPAC name is tert-butyl N-[1-[heptyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[heptyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18060135 |
| Molecular Formula | C30H43N3O5S |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | tert-butyl N-[1-[heptyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1ccccc1O |
| InChI | InChI=1S/C30H43N3O5S/c1-6-7-8-9-14-19-33(28(36)24(20-39)32-29(37)38-30(3,4)5)26(22-16-11-13-18-25(22)34)27(35)31-23-17-12-10-15-21(23)2/h10-13,15-18,24,26,34,39H,6-9,14,19-20H2,1-5H3,(H,31,35)(H,32,37) |
| InChIKey | YPGJLYKAZPQFMS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|