C35H45N3O6 — CID 18211357
tert-butyl N-[1-[hexyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18211357) has the molecular formula C35H45N3O6 and a molecular weight of 603.76 g/mol. Its IUPAC name is tert-butyl N-[1-[hexyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[hexyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18211357 |
| Molecular Formula | C35H45N3O6 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | tert-butyl N-[1-[hexyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1ccccc1O |
| InChI | InChI=1S/C35H45N3O6/c1-6-7-8-13-22-38(31(27-15-10-12-17-30(27)40)32(41)36-28-16-11-9-14-24(28)2)33(42)29(37-34(43)44-35(3,4)5)23-25-18-20-26(39)21-19-25/h9-12,14-21,29,31,39-40H,6-8,13,22-23H2,1-5H3,(H,36,41)(H,37,43) |
| InChIKey | WDYKYTOPPAXDCW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|