C34H43N3O6 — CID 18210787
tert-butyl N-[3-(4-hydroxyphenyl)-1-[[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]-pentylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18210787) has the molecular formula C34H43N3O6 and a molecular weight of 589.73 g/mol. Its IUPAC name is tert-butyl N-[3-(4-hydroxyphenyl)-1-[[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]-pentylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(4-hydroxyphenyl)-1-[[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]-pentylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18210787 |
| Molecular Formula | C34H43N3O6 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | tert-butyl N-[3-(4-hydroxyphenyl)-1-[[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]-pentylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCN(C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1ccccc1O |
| InChI | InChI=1S/C34H43N3O6/c1-6-7-12-21-37(30(26-14-9-11-16-29(26)39)31(40)35-27-15-10-8-13-23(27)2)32(41)28(36-33(42)43-34(3,4)5)22-24-17-19-25(38)20-18-24/h8-11,13-20,28,30,38-39H,6-7,12,21-22H2,1-5H3,(H,35,40)(H,36,42) |
| InChIKey | DKUUKUMIWBPODU-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|