C36H47N3O4 — CID 18217072
tert-butyl N-[1-[hexyl-[2-(2-methylanilino)-1-(2-methylphenyl)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217072) has the molecular formula C36H47N3O4 and a molecular weight of 585.79 g/mol. Its IUPAC name is tert-butyl N-[1-[hexyl-[2-(2-methylanilino)-1-(2-methylphenyl)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[hexyl-[2-(2-methylanilino)-1-(2-methylphenyl)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217072 |
| Molecular Formula | C36H47N3O4 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.36 |
| IUPAC Name | tert-butyl N-[1-[hexyl-[2-(2-methylanilino)-1-(2-methylphenyl)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1ccccc1C |
| InChI | InChI=1S/C36H47N3O4/c1-7-8-9-17-24-39(34(41)31(25-28-20-11-10-12-21-28)38-35(42)43-36(4,5)6)32(29-22-15-13-18-26(29)2)33(40)37-30-23-16-14-19-27(30)3/h10-16,18-23,31-32H,7-9,17,24-25H2,1-6H3,(H,37,40)(H,38,42) |
| InChIKey | DDKKOWIKWIVBCR-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|