C36H47N3O4 — CID 18216637
tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18216637) has the molecular formula C36H47N3O4 and a molecular weight of 585.79 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18216637 |
| Molecular Formula | C36H47N3O4 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.36 |
| IUPAC Name | tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C36H47N3O4/c1-8-9-15-20-39(34(41)31(24-28-17-11-10-12-18-28)38-35(42)43-36(5,6)7)32(29-22-25(2)21-26(3)23-29)33(40)37-30-19-14-13-16-27(30)4/h10-14,16-19,21-23,31-32H,8-9,15,20,24H2,1-7H3,(H,37,40)(H,38,42) |
| InChIKey | MHEYZDVBAGQGHX-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|