C40H55N3O4 — CID 18218065
tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18218065) has the molecular formula C40H55N3O4 and a molecular weight of 641.90 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18218065 |
| Molecular Formula | C40H55N3O4 |
| Molecular Weight | 641.90 g/mol |
| Exact Mass | 641.42 |
| IUPAC Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C40H55N3O4/c1-9-10-11-12-13-17-23-43(38(45)34(27-32-21-15-14-16-22-32)41-39(46)47-40(6,7)8)36(33-25-28(2)24-29(3)26-33)37(44)42-35-30(4)19-18-20-31(35)5/h14-16,18-22,24-26,34,36H,9-13,17,23,27H2,1-8H3,(H,41,46)(H,42,44) |
| InChIKey | CXABIOSHYYRLOS-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.90 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|