C36H47N3O5 — CID 18216655
tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18216655) has the molecular formula C36H47N3O5 and a molecular weight of 601.79 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18216655 |
| Molecular Formula | C36H47N3O5 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C)c1cccc(C)c1O |
| InChI | InChI=1S/C36H47N3O5/c1-8-9-13-22-39(34(42)29(23-27-19-11-10-12-20-27)37-35(43)44-36(5,6)7)31(28-21-15-18-26(4)32(28)40)33(41)38-30-24(2)16-14-17-25(30)3/h10-12,14-21,29,31,40H,8-9,13,22-23H2,1-7H3,(H,37,43)(H,38,41) |
| InChIKey | SSRVFZFRVFBASP-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|