C34H50N4O5 — CID 18065985
tert-butyl N-[5-amino-1-[[1-(3,5-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18065985) has the molecular formula C34H50N4O5 and a molecular weight of 594.80 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[1-(3,5-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[1-(3,5-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18065985 |
| Molecular Formula | C34H50N4O5 |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.38 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[1-(3,5-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-heptylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C34H50N4O5/c1-8-9-10-11-14-19-38(32(41)28(17-18-29(35)39)37-33(42)43-34(5,6)7)30(26-21-23(2)20-24(3)22-26)31(40)36-27-16-13-12-15-25(27)4/h12-13,15-16,20-22,28,30H,8-11,14,17-19H2,1-7H3,(H2,35,39)(H,36,40)(H,37,42) |
| InChIKey | YWTAECHMFRAXQK-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|