C35H48N4O5 — CID 18066210
tert-butyl N-[5-amino-1-[[1-(4-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18066210) has the molecular formula C35H48N4O5 and a molecular weight of 604.79 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[1-(4-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[1-(4-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18066210 |
| Molecular Formula | C35H48N4O5 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[1-(4-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-octylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2ccccc2C)N(CCCCCCCC)C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C35H48N4O5/c1-7-9-10-11-12-15-24-39(33(42)29(22-23-30(36)40)38-34(43)44-35(4,5)6)31(27-20-18-26(8-2)19-21-27)32(41)37-28-17-14-13-16-25(28)3/h2,13-14,16-21,29,31H,7,9-12,15,22-24H2,1,3-6H3,(H2,36,40)(H,37,41)(H,38,43) |
| InChIKey | RJOHOSUZTVYCKB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|