C31H41N3O4 — CID 18014055
tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014055) has the molecular formula C31H41N3O4 and a molecular weight of 519.69 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014055 |
| Molecular Formula | C31H41N3O4 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2ccccc2C)N(CCCCCC)C(=O)C(C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H41N3O4/c1-8-10-11-14-21-34(29(36)23(4)32-30(37)38-31(5,6)7)27(25-19-17-24(9-2)18-20-25)28(35)33-26-16-13-12-15-22(26)3/h2,12-13,15-20,23,27H,8,10-11,14,21H2,1,3-7H3,(H,32,37)(H,33,35) |
| InChIKey | WVURSSNTPZQIRH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|