C39H53N3O4 — CID 18218137
tert-butyl N-[1-[[1-(2,6-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18218137) has the molecular formula C39H53N3O4 and a molecular weight of 627.87 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2,6-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2,6-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18218137 |
| Molecular Formula | C39H53N3O4 |
| Molecular Weight | 627.87 g/mol |
| Exact Mass | 627.40 |
| IUPAC Name | tert-butyl N-[1-[[1-(2,6-dimethylphenyl)-2-(2-methylanilino)-2-oxoethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1c(C)cccc1C |
| InChI | InChI=1S/C39H53N3O4/c1-8-9-10-11-12-18-26-42(37(44)33(27-31-23-14-13-15-24-31)41-38(45)46-39(5,6)7)35(34-29(3)21-19-22-30(34)4)36(43)40-32-25-17-16-20-28(32)2/h13-17,19-25,33,35H,8-12,18,26-27H2,1-7H3,(H,40,43)(H,41,45) |
| InChIKey | WVYGPBYOTDZUKC-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.87 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|