C37H57N3O4 — CID 18218134
tert-butyl N-[1-[[1-(2,6-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18218134) has the molecular formula C37H57N3O4 and a molecular weight of 607.88 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2,6-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2,6-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18218134 |
| Molecular Formula | C37H57N3O4 |
| Molecular Weight | 607.88 g/mol |
| Exact Mass | 607.43 |
| IUPAC Name | tert-butyl N-[1-[[1-(2,6-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-octylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1c(C)cccc1C |
| InChI | InChI=1S/C37H57N3O4/c1-8-10-12-13-14-19-26-40(33(34(41)38-25-18-11-9-2)32-28(3)21-20-22-29(32)4)35(42)31(27-30-23-16-15-17-24-30)39-36(43)44-37(5,6)7/h15-17,20-24,31,33H,8-14,18-19,25-27H2,1-7H3,(H,38,41)(H,39,43) |
| InChIKey | REYFRTFJJKOQNQ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.88 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|