C37H55N3O4 — CID 18217850
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217850) has the molecular formula C37H55N3O4 and a molecular weight of 605.86 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217850 |
| Molecular Formula | C37H55N3O4 |
| Molecular Weight | 605.86 g/mol |
| Exact Mass | 605.42 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1c(C)cccc1C |
| InChI | InChI=1S/C37H55N3O4/c1-7-8-9-10-17-25-40(35(42)31(26-29-21-13-11-14-22-29)39-36(43)44-37(4,5)6)33(32-27(2)19-18-20-28(32)3)34(41)38-30-23-15-12-16-24-30/h11,13-14,18-22,30-31,33H,7-10,12,15-17,23-26H2,1-6H3,(H,38,41)(H,39,43) |
| InChIKey | GIIJZXKKKQGUSH-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.86 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|