C35H51N3O4 — CID 18216725
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18216725) has the molecular formula C35H51N3O4 and a molecular weight of 577.81 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18216725 |
| Molecular Formula | C35H51N3O4 |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 577.39 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-pentylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCN(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1cc(C)ccc1C |
| InChI | InChI=1S/C35H51N3O4/c1-7-8-15-22-38(33(40)30(24-27-16-11-9-12-17-27)37-34(41)42-35(4,5)6)31(29-23-25(2)20-21-26(29)3)32(39)36-28-18-13-10-14-19-28/h9,11-12,16-17,20-21,23,28,30-31H,7-8,10,13-15,18-19,22,24H2,1-6H3,(H,36,39)(H,37,41) |
| InChIKey | BEBMXEDPCLEYDA-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|